C18H21NO5S — CID 70516091
benzyl (3-tert-butylsulfinyl-7-oxo-1-azabicyclo[3.2.0]hept-2-en-2-yl) carbonate (PubChem CID 70516091) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is benzyl (3-tert-butylsulfinyl-7-oxo-1-azabicyclo[3.2.0]hept-2-en-2-yl) carbonate.
| Compound Name | benzyl (3-tert-butylsulfinyl-7-oxo-1-azabicyclo[3.2.0]hept-2-en-2-yl) carbonate |
|---|---|
| PubChem CID | 70516091 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | benzyl (3-tert-butylsulfinyl-7-oxo-1-azabicyclo[3.2.0]hept-2-en-2-yl) carbonate |
| SMILES | CC(C)(C)S(=O)C1=C(OC(=O)OCc2ccccc2)N2C(=O)CC2C1 |
| InChI | InChI=1S/C18H21NO5S/c1-18(2,3)25(22)14-9-13-10-15(20)19(13)16(14)24-17(21)23-11-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3 |
| InChIKey | XLEOIURRJRBMIX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |