C28H24O8 — CID 134590867
bis(phenylmethoxycarbonyl) 1,2,3,4-tetrahydronaphthalene-1,4-dicarboxylate (PubChem CID 134590867) has the molecular formula C28H24O8 and a molecular weight of 488.49 g/mol. Its IUPAC name is bis(phenylmethoxycarbonyl) 1,2,3,4-tetrahydronaphthalene-1,4-dicarboxylate.
| Compound Name | bis(phenylmethoxycarbonyl) 1,2,3,4-tetrahydronaphthalene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 134590867 |
| Molecular Formula | C28H24O8 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | bis(phenylmethoxycarbonyl) 1,2,3,4-tetrahydronaphthalene-1,4-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)OC(=O)C1CCC(C(=O)OC(=O)OCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C28H24O8/c29-25(35-27(31)33-17-19-9-3-1-4-10-19)23-15-16-24(22-14-8-7-13-21(22)23)26(30)36-28(32)34-18-20-11-5-2-6-12-20/h1-14,23-24H,15-18H2 |
| InChIKey | XIFJEVYGWWMMAF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|