C13H15NO4 — CID 10198836
benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate (PubChem CID 10198836) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10198836 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1OC(=O)C(C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H15NO4/c1-9-12(15)18-10(2)14(9)13(16)17-8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | HXIQZAPHJWDKEF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |