benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate

C13H15NO4 — CID 10198836

IUPACbenzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate
SMILESCC1OC(=O)C(C)N1C(=O)OCc1ccccc1
InChIInChI=1S/C13H15NO4/c1-9-12(15)18-10(2)14(9)13(16)17-8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3
InChIKeyHXIQZAPHJWDKEF-UHFFFAOYSA-N
MW249.27 g/mol
LogP1.92
Rot. Bonds2

About benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate

benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate (PubChem CID 10198836) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate.

Molecular Properties

Compound Namebenzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate
PubChem CID10198836
Molecular FormulaC13H15NO4
Molecular Weight249.27 g/mol
Exact Mass249.10
IUPAC Namebenzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate
SMILESCC1OC(=O)C(C)N1C(=O)OCc1ccccc1
InChIInChI=1S/C13H15NO4/c1-9-12(15)18-10(2)14(9)13(16)17-8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3
InChIKeyHXIQZAPHJWDKEF-UHFFFAOYSA-N
XLogP1.92
TPSA55.84 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.27
LogP ≤ 51.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate?
The IUPAC name of benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate (CID 10198836) is benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate.
What is the SMILES notation for benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate?
The canonical SMILES for benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate is CC1OC(=O)C(C)N1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate?
The InChIKey is HXIQZAPHJWDKEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4/c1-9-12(15)18-10(2)14(9)13(16)17-8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3.
What are the key properties of benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate?
benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate has a molecular weight of 249.27 g/mol, XLogP of 1.92, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2,4-dimethyl-5-oxo-1,3-oxazolidine-3-carboxylate is sourced from PubChem (CID 10198836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).