C14H15NO3 — CID 18660116
benzyl (2R)-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate (PubChem CID 18660116) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is benzyl (2R)-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate.
| Compound Name | benzyl (2R)-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 18660116 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | benzyl (2R)-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate |
| SMILES | C[C@@H]1CC(=O)C=CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H15NO3/c1-11-9-13(16)7-8-15(11)14(17)18-10-12-5-3-2-4-6-12/h2-8,11H,9-10H2,1H3/t11-/m1/s1 |
| InChIKey | CZZXYDLQRNIZGZ-LLVKDONJSA-N |
| XLogP | 2.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |