C20H19NO3 — CID 86333984
benzyl (2R)-2-benzyl-4-oxo-2,3-dihydropyridine-1-carboxylate (PubChem CID 86333984) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is benzyl (2R)-2-benzyl-4-oxo-2,3-dihydropyridine-1-carboxylate.
| Compound Name | benzyl (2R)-2-benzyl-4-oxo-2,3-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 86333984 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | benzyl (2R)-2-benzyl-4-oxo-2,3-dihydropyridine-1-carboxylate |
| SMILES | O=C1C=CN(C(=O)OCc2ccccc2)[C@H](Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H19NO3/c22-19-11-12-21(18(14-19)13-16-7-3-1-4-8-16)20(23)24-15-17-9-5-2-6-10-17/h1-12,18H,13-15H2/t18-/m1/s1 |
| InChIKey | CPPWUCAZPYCXLB-GOSISDBHSA-N |
| XLogP | 3.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |