C21H21NO3 — CID 139253604
benzyl (2S)-2-benzyl-5-methyl-3-oxo-2,4-dihydropyridine-1-carboxylate (PubChem CID 139253604) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is benzyl (2S)-2-benzyl-5-methyl-3-oxo-2,4-dihydropyridine-1-carboxylate.
| Compound Name | benzyl (2S)-2-benzyl-5-methyl-3-oxo-2,4-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 139253604 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | benzyl (2S)-2-benzyl-5-methyl-3-oxo-2,4-dihydropyridine-1-carboxylate |
| SMILES | CC1=CN(C(=O)OCc2ccccc2)[C@@H](Cc2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C21H21NO3/c1-16-12-20(23)19(13-17-8-4-2-5-9-17)22(14-16)21(24)25-15-18-10-6-3-7-11-18/h2-11,14,19H,12-13,15H2,1H3/t19-/m0/s1 |
| InChIKey | ISIUNPDYZYBYCW-IBGZPJMESA-N |
| XLogP | 4.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |