C26H26N2O3 — CID 101170964
benzyl (2R)-2,4-dibenzyl-3-oxopiperazine-1-carboxylate (PubChem CID 101170964) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is benzyl (2R)-2,4-dibenzyl-3-oxopiperazine-1-carboxylate.
| Compound Name | benzyl (2R)-2,4-dibenzyl-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 101170964 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | benzyl (2R)-2,4-dibenzyl-3-oxopiperazine-1-carboxylate |
| SMILES | O=C1[C@@H](Cc2ccccc2)N(C(=O)OCc2ccccc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C26H26N2O3/c29-25-24(18-21-10-4-1-5-11-21)28(26(30)31-20-23-14-8-3-9-15-23)17-16-27(25)19-22-12-6-2-7-13-22/h1-15,24H,16-20H2/t24-/m1/s1 |
| InChIKey | VBROIRHBCGJLAS-XMMPIXPASA-N |
| XLogP | 4.28 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |