C17H22N2O6 — CID 67074471
(3R)-3-hydroxy-4-[(3S)-3-methyl-2-oxo-4-phenylmethoxycarbonylpiperazin-1-yl]butanoic acid (PubChem CID 67074471) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is (3R)-3-hydroxy-4-[(3S)-3-methyl-2-oxo-4-phenylmethoxycarbonylpiperazin-1-yl]butanoic acid.
| Compound Name | (3R)-3-hydroxy-4-[(3S)-3-methyl-2-oxo-4-phenylmethoxycarbonylpiperazin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 67074471 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (3R)-3-hydroxy-4-[(3S)-3-methyl-2-oxo-4-phenylmethoxycarbonylpiperazin-1-yl]butanoic acid |
| SMILES | C[C@H]1C(=O)N(C[C@H](O)CC(=O)O)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H22N2O6/c1-12-16(23)18(10-14(20)9-15(21)22)7-8-19(12)17(24)25-11-13-5-3-2-4-6-13/h2-6,12,14,20H,7-11H2,1H3,(H,21,22)/t12-,14+/m0/s1 |
| InChIKey | BGJGKZMFNWQQQX-GXTWGEPZSA-N |
| XLogP | 0.69 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |