C18H14BrNO5 — CID 102378636
benzyl 4-[(4-bromophenyl)methyl]-2,5-dioxo-1,3-oxazolidine-3-carboxylate (PubChem CID 102378636) has the molecular formula C18H14BrNO5 and a molecular weight of 404.22 g/mol. Its IUPAC name is benzyl 4-[(4-bromophenyl)methyl]-2,5-dioxo-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl 4-[(4-bromophenyl)methyl]-2,5-dioxo-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 102378636 |
| Molecular Formula | C18H14BrNO5 |
| Molecular Weight | 404.22 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | benzyl 4-[(4-bromophenyl)methyl]-2,5-dioxo-1,3-oxazolidine-3-carboxylate |
| SMILES | O=C1OC(=O)N(C(=O)OCc2ccccc2)C1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H14BrNO5/c19-14-8-6-12(7-9-14)10-15-16(21)25-18(23)20(15)17(22)24-11-13-4-2-1-3-5-13/h1-9,15H,10-11H2 |
| InChIKey | KKZLNFIVDLBJSK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.22 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|