benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate

C15H11NO6 — CID 101202260

IUPACbenzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate
SMILESO=C1OC(=O)N(C(=O)OCc2ccccc2)C1c1ccco1
InChIInChI=1S/C15H11NO6/c17-13-12(11-7-4-8-20-11)16(15(19)22-13)14(18)21-9-10-5-2-1-3-6-10/h1-8,12H,9H2
InChIKeyPPJUVRSYKOXCOF-UHFFFAOYSA-N
MW301.25 g/mol
LogP2.64
Rot. Bonds3

About benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate

benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate (PubChem CID 101202260) has the molecular formula C15H11NO6 and a molecular weight of 301.25 g/mol. Its IUPAC name is benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate.

Molecular Properties

Compound Namebenzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate
PubChem CID101202260
Molecular FormulaC15H11NO6
Molecular Weight301.25 g/mol
Exact Mass301.06
IUPAC Namebenzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate
SMILESO=C1OC(=O)N(C(=O)OCc2ccccc2)C1c1ccco1
InChIInChI=1S/C15H11NO6/c17-13-12(11-7-4-8-20-11)16(15(19)22-13)14(18)21-9-10-5-2-1-3-6-10/h1-8,12H,9H2
InChIKeyPPJUVRSYKOXCOF-UHFFFAOYSA-N
XLogP2.64
TPSA86.05 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.25
LogP ≤ 52.64
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate?
The IUPAC name of benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate (CID 101202260) is benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate.
What is the SMILES notation for benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate?
The canonical SMILES for benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate is O=C1OC(=O)N(C(=O)OCc2ccccc2)C1c1ccco1.
What is the InChIKey of benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate?
The InChIKey is PPJUVRSYKOXCOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO6/c17-13-12(11-7-4-8-20-11)16(15(19)22-13)14(18)21-9-10-5-2-1-3-6-10/h1-8,12H,9H2.
What are the key properties of benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate?
benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate has a molecular weight of 301.25 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate is sourced from PubChem (CID 101202260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).