C15H11NO6 — CID 101202260
benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate (PubChem CID 101202260) has the molecular formula C15H11NO6 and a molecular weight of 301.25 g/mol. Its IUPAC name is benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 101202260 |
| Molecular Formula | C15H11NO6 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | benzyl 4-(furan-2-yl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate |
| SMILES | O=C1OC(=O)N(C(=O)OCc2ccccc2)C1c1ccco1 |
| InChI | InChI=1S/C15H11NO6/c17-13-12(11-7-4-8-20-11)16(15(19)22-13)14(18)21-9-10-5-2-1-3-6-10/h1-8,12H,9H2 |
| InChIKey | PPJUVRSYKOXCOF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|