C28H30N2O8 — CID 59837887
dibenzyl 2,5-dioxo-3,6-bis(3-oxobutyl)piperazine-1,4-dicarboxylate (PubChem CID 59837887) has the molecular formula C28H30N2O8 and a molecular weight of 522.55 g/mol. Its IUPAC name is dibenzyl 2,5-dioxo-3,6-bis(3-oxobutyl)piperazine-1,4-dicarboxylate.
| Compound Name | dibenzyl 2,5-dioxo-3,6-bis(3-oxobutyl)piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 59837887 |
| Molecular Formula | C28H30N2O8 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | dibenzyl 2,5-dioxo-3,6-bis(3-oxobutyl)piperazine-1,4-dicarboxylate |
| SMILES | CC(=O)CCC1C(=O)N(C(=O)OCc2ccccc2)C(CCC(C)=O)C(=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H30N2O8/c1-19(31)13-15-23-25(33)30(28(36)38-18-22-11-7-4-8-12-22)24(16-14-20(2)32)26(34)29(23)27(35)37-17-21-9-5-3-6-10-21/h3-12,23-24H,13-18H2,1-2H3 |
| InChIKey | FMOPYRJVUHVJMD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |