C13H15N3O3 — CID 10467824
benzyl (4S)-2-amino-4-ethyl-5-oxo-4H-imidazole-3-carboxylate (PubChem CID 10467824) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is benzyl (4S)-2-amino-4-ethyl-5-oxo-4H-imidazole-3-carboxylate.
| Compound Name | benzyl (4S)-2-amino-4-ethyl-5-oxo-4H-imidazole-3-carboxylate |
|---|---|
| PubChem CID | 10467824 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | benzyl (4S)-2-amino-4-ethyl-5-oxo-4H-imidazole-3-carboxylate |
| SMILES | CC[C@H]1C(=O)N=C(N)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H15N3O3/c1-2-10-11(17)15-12(14)16(10)13(18)19-8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H2,14,15,17)/t10-/m0/s1 |
| InChIKey | HULXVBXGNAXYNI-JTQLQIEISA-N |
| XLogP | 1.26 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |