C23H19N3O3 — CID 15054174
benzyl 2-amino-4-oxo-5,5-diphenylimidazole-1-carboxylate (PubChem CID 15054174) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is benzyl 2-amino-4-oxo-5,5-diphenylimidazole-1-carboxylate.
| Compound Name | benzyl 2-amino-4-oxo-5,5-diphenylimidazole-1-carboxylate |
|---|---|
| PubChem CID | 15054174 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | benzyl 2-amino-4-oxo-5,5-diphenylimidazole-1-carboxylate |
| SMILES | NC1=NC(=O)C(c2ccccc2)(c2ccccc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H19N3O3/c24-21-25-20(27)23(18-12-6-2-7-13-18,19-14-8-3-9-15-19)26(21)22(28)29-16-17-10-4-1-5-11-17/h1-15H,16H2,(H2,24,25,27) |
| InChIKey | SETWNPPHVLVPCH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |