C23H35NO4Si — CID 54512458
benzyl (2S,3R)-2-cyclohexyl-4-oxo-3-triethylsilyloxyazetidine-1-carboxylate (PubChem CID 54512458) has the molecular formula C23H35NO4Si and a molecular weight of 417.62 g/mol. Its IUPAC name is benzyl (2S,3R)-2-cyclohexyl-4-oxo-3-triethylsilyloxyazetidine-1-carboxylate.
| Compound Name | benzyl (2S,3R)-2-cyclohexyl-4-oxo-3-triethylsilyloxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 54512458 |
| Molecular Formula | C23H35NO4Si |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | benzyl (2S,3R)-2-cyclohexyl-4-oxo-3-triethylsilyloxyazetidine-1-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@H]1C(=O)N(C(=O)OCc2ccccc2)[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C23H35NO4Si/c1-4-29(5-2,6-3)28-21-20(19-15-11-8-12-16-19)24(22(21)25)23(26)27-17-18-13-9-7-10-14-18/h7,9-10,13-14,19-21H,4-6,8,11-12,15-17H2,1-3H3/t20-,21+/m0/s1 |
| InChIKey | YKCCVXWBQRDVBQ-LEWJYISDSA-N |
| XLogP | 5.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|