C13H15NO3S — CID 101361349
benzyl (3R)-3-methyl-1-oxo-3,6-dihydrothiazine-2-carboxylate (PubChem CID 101361349) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is benzyl (3R)-3-methyl-1-oxo-3,6-dihydrothiazine-2-carboxylate.
| Compound Name | benzyl (3R)-3-methyl-1-oxo-3,6-dihydrothiazine-2-carboxylate |
|---|---|
| PubChem CID | 101361349 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | benzyl (3R)-3-methyl-1-oxo-3,6-dihydrothiazine-2-carboxylate |
| SMILES | C[C@@H]1C=CCS(=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H15NO3S/c1-11-6-5-9-18(16)14(11)13(15)17-10-12-7-3-2-4-8-12/h2-8,11H,9-10H2,1H3/t11-,18?/m1/s1 |
| InChIKey | SLSMIJBCPINYMP-SSJGJQFISA-N |
| XLogP | 2.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|