C17H23NO2 — CID 158629836
benzyl (3S,4S,7S)-3,4,7-trimethyl-2,3,4,7-tetrahydroazepine-1-carboxylate (PubChem CID 158629836) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is benzyl (3S,4S,7S)-3,4,7-trimethyl-2,3,4,7-tetrahydroazepine-1-carboxylate.
| Compound Name | benzyl (3S,4S,7S)-3,4,7-trimethyl-2,3,4,7-tetrahydroazepine-1-carboxylate |
|---|---|
| PubChem CID | 158629836 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | benzyl (3S,4S,7S)-3,4,7-trimethyl-2,3,4,7-tetrahydroazepine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OCc2ccccc2)[C@@H](C)C=C[C@@H]1C |
| InChI | InChI=1S/C17H23NO2/c1-13-9-10-15(3)18(11-14(13)2)17(19)20-12-16-7-5-4-6-8-16/h4-10,13-15H,11-12H2,1-3H3/t13-,14+,15-/m0/s1 |
| InChIKey | PIKDORHIALFYMN-ZNMIVQPWSA-N |
| XLogP | 3.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|