C23H24N2O2 — CID 23057926
benzene;benzyl 2-methyl-3,4-dihydro-2H-quinoxaline-1-carboxylate (PubChem CID 23057926) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is benzene;benzyl 2-methyl-3,4-dihydro-2H-quinoxaline-1-carboxylate.
| Compound Name | benzene;benzyl 2-methyl-3,4-dihydro-2H-quinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 23057926 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | benzene;benzyl 2-methyl-3,4-dihydro-2H-quinoxaline-1-carboxylate |
| SMILES | CC1CNc2ccccc2N1C(=O)OCc1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C17H18N2O2.C6H6/c1-13-11-18-15-9-5-6-10-16(15)19(13)17(20)21-12-14-7-3-2-4-8-14;1-2-4-6-5-3-1/h2-10,13,18H,11-12H2,1H3;1-6H |
| InChIKey | FNWRXLMUQSNSJY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |