2-ethyl-3,4-dihydro-2H-quinoxaline-1-carboxylic acid

C11H14N2O2 — CID 142774277

IUPAC2-ethyl-3,4-dihydro-2H-quinoxaline-1-carboxylic acid
SMILESCCC1CNc2ccccc2N1C(=O)O
InChIInChI=1S/C11H14N2O2/c1-2-8-7-12-9-5-3-4-6-10(9)13(8)11(14)15/h3-6,8,12H,2,7H2,1H3,(H,14,15)
InChIKeyXBRVGXIAWRCGDY-UHFFFAOYSA-N
MW206.25 g/mol
LogP2.38
Rot. Bonds1

About 2-ethyl-3,4-dihydro-2H-quinoxaline-1-carboxylic acid

2-ethyl-3,4-dihydro-2H-quinoxaline-1-carboxylic acid (PubChem CID 142774277) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-ethyl-3,4-dihydro-2H-quinoxaline-1-carboxylic acid.

Molecular Properties

Compound Name2-ethyl-3,4-dihydro-2H-quinoxaline-1-carboxylic acid
PubChem CID142774277
Molecular FormulaC11H14N2O2
Molecular Weight206.25 g/mol
Exact Mass206.11
IUPAC Name2-ethyl-3,4-dihydro-2H-quinoxaline-1-carboxylic acid
SMILESCCC1CNc2ccccc2N1C(=O)O
InChIInChI=1S/C11H14N2O2/c1-2-8-7-12-9-5-3-4-6-10(9)13(8)11(14)15/h3-6,8,12H,2,7H2,1H3,(H,14,15)
InChIKeyXBRVGXIAWRCGDY-UHFFFAOYSA-N
XLogP2.38
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.25
LogP ≤ 52.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-ethyl-3,4-dihydro-2H-quinoxaline-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-3,4-dihydro-2H-quinoxaline-1-carboxylic acid?
The IUPAC name of 2-ethyl-3,4-dihydro-2H-quinoxaline-1-carboxylic acid (CID 142774277) is 2-ethyl-3,4-dihydro-2H-quinoxaline-1-carboxylic acid.
What is the SMILES notation for 2-ethyl-3,4-dihydro-2H-quinoxaline-1-carboxylic acid?
The canonical SMILES for 2-ethyl-3,4-dihydro-2H-quinoxaline-1-carboxylic acid is CCC1CNc2ccccc2N1C(=O)O.
What is the InChIKey of 2-ethyl-3,4-dihydro-2H-quinoxaline-1-carboxylic acid?
The InChIKey is XBRVGXIAWRCGDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-2-8-7-12-9-5-3-4-6-10(9)13(8)11(14)15/h3-6,8,12H,2,7H2,1H3,(H,14,15).
What are the key properties of 2-ethyl-3,4-dihydro-2H-quinoxaline-1-carboxylic acid?
2-ethyl-3,4-dihydro-2H-quinoxaline-1-carboxylic acid has a molecular weight of 206.25 g/mol, XLogP of 2.38, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3,4-dihydro-2H-quinoxaline-1-carboxylic acid is sourced from PubChem (CID 142774277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).