About 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid
2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid (PubChem CID 174810540) has the molecular formula C10H11FN2O3
and a molecular weight of 226.21 g/mol. Its IUPAC name is 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid.
Analyze 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid?
The IUPAC name of 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid (CID 174810540) is 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid.
What is the SMILES notation for 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid?
The canonical SMILES for 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid is O=C(O)N1c2ccccc2NCC1OCF.
What is the InChIKey of 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid?
The InChIKey is YLYRYJNJZKQQRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2O3/c11-6-16-9-5-12-7-3-1-2-4-8(7)13(9)10(14)15/h1-4,9,12H,5-6H2,(H,14,15).
What are the key properties of 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid?
2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid has a molecular weight of 226.21 g/mol, XLogP of 1.87, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid is sourced from PubChem (CID 174810540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).