2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid

C10H11FN2O3 — CID 174810540

IUPAC2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid
SMILESO=C(O)N1c2ccccc2NCC1OCF
InChIInChI=1S/C10H11FN2O3/c11-6-16-9-5-12-7-3-1-2-4-8(7)13(9)10(14)15/h1-4,9,12H,5-6H2,(H,14,15)
InChIKeyYLYRYJNJZKQQRB-UHFFFAOYSA-N
MW226.21 g/mol
LogP1.87
Rot. Bonds2

About 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid

2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid (PubChem CID 174810540) has the molecular formula C10H11FN2O3 and a molecular weight of 226.21 g/mol. Its IUPAC name is 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid.

Molecular Properties

Compound Name2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid
PubChem CID174810540
Molecular FormulaC10H11FN2O3
Molecular Weight226.21 g/mol
Exact Mass226.08
IUPAC Name2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid
SMILESO=C(O)N1c2ccccc2NCC1OCF
InChIInChI=1S/C10H11FN2O3/c11-6-16-9-5-12-7-3-1-2-4-8(7)13(9)10(14)15/h1-4,9,12H,5-6H2,(H,14,15)
InChIKeyYLYRYJNJZKQQRB-UHFFFAOYSA-N
XLogP1.87
TPSA61.80 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.21
LogP ≤ 51.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid?
The IUPAC name of 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid (CID 174810540) is 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid.
What is the SMILES notation for 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid?
The canonical SMILES for 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid is O=C(O)N1c2ccccc2NCC1OCF.
What is the InChIKey of 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid?
The InChIKey is YLYRYJNJZKQQRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2O3/c11-6-16-9-5-12-7-3-1-2-4-8(7)13(9)10(14)15/h1-4,9,12H,5-6H2,(H,14,15).
What are the key properties of 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid?
2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid has a molecular weight of 226.21 g/mol, XLogP of 1.87, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluoromethoxy)-3,4-dihydro-2H-quinoxaline-1-carboxylic acid is sourced from PubChem (CID 174810540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).