C14H19ClN2O2 — CID 145328642
2-chloro-1-[2-[(Z)-1-methoxyprop-1-enyl]-3,4-dihydro-2H-quinoxalin-1-yl]ethanone;molecular hydrogen (PubChem CID 145328642) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 2-chloro-1-[2-[(Z)-1-methoxyprop-1-enyl]-3,4-dihydro-2H-quinoxalin-1-yl]ethanone;molecular hydrogen.
| Compound Name | 2-chloro-1-[2-[(Z)-1-methoxyprop-1-enyl]-3,4-dihydro-2H-quinoxalin-1-yl]ethanone;molecular hydrogen |
|---|---|
| PubChem CID | 145328642 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-chloro-1-[2-[(Z)-1-methoxyprop-1-enyl]-3,4-dihydro-2H-quinoxalin-1-yl]ethanone;molecular hydrogen |
| SMILES | C/C=C(\OC)C1CNc2ccccc2N1C(=O)CCl.[H][H] |
| InChI | InChI=1S/C14H17ClN2O2.H2/c1-3-13(19-2)12-9-16-10-6-4-5-7-11(10)17(12)14(18)8-15;/h3-7,12,16H,8-9H2,1-2H3;1H/b13-3-; |
| InChIKey | VXLGQAPQBDCOKU-OUPYKXEUSA-N |
| XLogP | 2.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|