C19H23ClN2O2 — CID 41090060
(6S)-5-(2-chloroacetyl)-6-ethyl-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 41090060) has the molecular formula C19H23ClN2O2 and a molecular weight of 346.86 g/mol. Its IUPAC name is (6S)-5-(2-chloroacetyl)-6-ethyl-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6S)-5-(2-chloroacetyl)-6-ethyl-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 41090060 |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (6S)-5-(2-chloroacetyl)-6-ethyl-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC[C@H]1C2=C(CC(C)(C)CC2=O)Nc2ccccc2N1C(=O)CCl |
| InChI | InChI=1S/C19H23ClN2O2/c1-4-14-18-13(9-19(2,3)10-16(18)23)21-12-7-5-6-8-15(12)22(14)17(24)11-20/h5-8,14,21H,4,9-11H2,1-3H3/t14-/m0/s1 |
| InChIKey | KIVXJBZEAOJHGN-AWEZNQCLSA-N |
| XLogP | 4.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|