C28H33N3O2 — CID 19056724
N-(2,3-dihydro-1H-inden-2-yl)-2-(6-ethyl-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)acetamide (PubChem CID 19056724) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-2-(6-ethyl-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)acetamide.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-2-(6-ethyl-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)acetamide |
|---|---|
| PubChem CID | 19056724 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-2-(6-ethyl-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)acetamide |
| SMILES | CCC1C2=C(CC(C)(C)CC2=O)Nc2ccccc2N1CC(=O)NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C28H33N3O2/c1-4-23-27-22(15-28(2,3)16-25(27)32)30-21-11-7-8-12-24(21)31(23)17-26(33)29-20-13-18-9-5-6-10-19(18)14-20/h5-12,20,23,30H,4,13-17H2,1-3H3,(H,29,33) |
| InChIKey | KRBKVLRMORQJRB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |