C30H37N3O3 — CID 41090345
N-cyclohexyl-2-[(6R)-6-(2-methoxyphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetamide (PubChem CID 41090345) has the molecular formula C30H37N3O3 and a molecular weight of 487.64 g/mol. Its IUPAC name is N-cyclohexyl-2-[(6R)-6-(2-methoxyphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[(6R)-6-(2-methoxyphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetamide |
|---|---|
| PubChem CID | 41090345 |
| Molecular Formula | C30H37N3O3 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | N-cyclohexyl-2-[(6R)-6-(2-methoxyphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetamide |
| SMILES | COc1ccccc1[C@@H]1C2=C(CC(C)(C)CC2=O)Nc2ccccc2N1CC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C30H37N3O3/c1-30(2)17-23-28(25(34)18-30)29(21-13-7-10-16-26(21)36-3)33(24-15-9-8-14-22(24)32-23)19-27(35)31-20-11-5-4-6-12-20/h7-10,13-16,20,29,32H,4-6,11-12,17-19H2,1-3H3,(H,31,35)/t29-/m1/s1 |
| InChIKey | PEWPOTWXRKYULJ-GDLZYMKVSA-N |
| XLogP | 5.76 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |