C31H39N3O4 — CID 19055332
N-cyclohexyl-2-[6-(2,3-dimethoxyphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetamide (PubChem CID 19055332) has the molecular formula C31H39N3O4 and a molecular weight of 517.67 g/mol. Its IUPAC name is N-cyclohexyl-2-[6-(2,3-dimethoxyphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[6-(2,3-dimethoxyphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetamide |
|---|---|
| PubChem CID | 19055332 |
| Molecular Formula | C31H39N3O4 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | N-cyclohexyl-2-[6-(2,3-dimethoxyphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetamide |
| SMILES | COc1cccc(C2C3=C(CC(C)(C)CC3=O)Nc3ccccc3N2CC(=O)NC2CCCCC2)c1OC |
| InChI | InChI=1S/C31H39N3O4/c1-31(2)17-23-28(25(35)18-31)29(21-13-10-16-26(37-3)30(21)38-4)34(24-15-9-8-14-22(24)33-23)19-27(36)32-20-11-6-5-7-12-20/h8-10,13-16,20,29,33H,5-7,11-12,17-19H2,1-4H3,(H,32,36) |
| InChIKey | UWNRBYINEGCIDO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |