C32H40N4O6 — CID 19055385
ethyl 4-[2-[6-(2,3-dimethoxyphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetyl]piperazine-1-carboxylate (PubChem CID 19055385) has the molecular formula C32H40N4O6 and a molecular weight of 576.69 g/mol. Its IUPAC name is ethyl 4-[2-[6-(2,3-dimethoxyphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[6-(2,3-dimethoxyphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 19055385 |
| Molecular Formula | C32H40N4O6 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | ethyl 4-[2-[6-(2,3-dimethoxyphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CN2c3ccccc3NC3=C(C(=O)CC(C)(C)C3)C2c2cccc(OC)c2OC)CC1 |
| InChI | InChI=1S/C32H40N4O6/c1-6-42-31(39)35-16-14-34(15-17-35)27(38)20-36-24-12-8-7-11-22(24)33-23-18-32(2,3)19-25(37)28(23)29(36)21-10-9-13-26(40-4)30(21)41-5/h7-13,29,33H,6,14-20H2,1-5H3 |
| InChIKey | VZGWDIQRCSNEHP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |