C30H34Cl2N4O4 — CID 19056052
ethyl 4-[2-[6-(3,4-dichlorophenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetyl]piperazine-1-carboxylate (PubChem CID 19056052) has the molecular formula C30H34Cl2N4O4 and a molecular weight of 585.53 g/mol. Its IUPAC name is ethyl 4-[2-[6-(3,4-dichlorophenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[6-(3,4-dichlorophenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 19056052 |
| Molecular Formula | C30H34Cl2N4O4 |
| Molecular Weight | 585.53 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | ethyl 4-[2-[6-(3,4-dichlorophenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CN2c3ccccc3NC3=C(C(=O)CC(C)(C)C3)C2c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C30H34Cl2N4O4/c1-4-40-29(39)35-13-11-34(12-14-35)26(38)18-36-24-8-6-5-7-22(24)33-23-16-30(2,3)17-25(37)27(23)28(36)19-9-10-20(31)21(32)15-19/h5-10,15,28,33H,4,11-14,16-18H2,1-3H3 |
| InChIKey | HAQKKSHDWOETMW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |