C34H36Cl2N4O3 — CID 19056047
6-(3,4-dichlorophenyl)-5-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 19056047) has the molecular formula C34H36Cl2N4O3 and a molecular weight of 619.59 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-5-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(3,4-dichlorophenyl)-5-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 19056047 |
| Molecular Formula | C34H36Cl2N4O3 |
| Molecular Weight | 619.59 g/mol |
| Exact Mass | 618.22 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-5-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1ccc(N2CCN(C(=O)CN3c4ccccc4NC4=C(C(=O)CC(C)(C)C4)C3c3ccc(Cl)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C34H36Cl2N4O3/c1-34(2)19-28-32(30(41)20-34)33(22-8-13-25(35)26(36)18-22)40(29-7-5-4-6-27(29)37-28)21-31(42)39-16-14-38(15-17-39)23-9-11-24(43-3)12-10-23/h4-13,18,33,37H,14-17,19-21H2,1-3H3 |
| InChIKey | KWJXWQUBWAQUJE-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.59 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|