C33H33F3N4O2 — CID 19056344
6-(3,5-difluorophenyl)-5-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 19056344) has the molecular formula C33H33F3N4O2 and a molecular weight of 574.65 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)-5-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(3,5-difluorophenyl)-5-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 19056344 |
| Molecular Formula | C33H33F3N4O2 |
| Molecular Weight | 574.65 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 6-(3,5-difluorophenyl)-5-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(CC(=O)N1CCN(c3ccc(F)cc3)CC1)C2c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C33H33F3N4O2/c1-33(2)18-27-31(29(41)19-33)32(21-15-23(35)17-24(36)16-21)40(28-6-4-3-5-26(28)37-27)20-30(42)39-13-11-38(12-14-39)25-9-7-22(34)8-10-25/h3-10,15-17,32,37H,11-14,18-20H2,1-2H3 |
| InChIKey | BMVHLPZDJGFSNQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.65 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |