C36H42N4O5 — CID 19055563
6-(3,4-dimethoxyphenyl)-5-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 19055563) has the molecular formula C36H42N4O5 and a molecular weight of 610.76 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-5-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(3,4-dimethoxyphenyl)-5-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 19055563 |
| Molecular Formula | C36H42N4O5 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.32 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-5-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1ccc(N2CCN(C(=O)CN3c4ccccc4NC4=C(C(=O)CC(C)(C)C4)C3c3ccc(OC)c(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C36H42N4O5/c1-36(2)21-28-34(30(41)22-36)35(24-10-15-31(44-4)32(20-24)45-5)40(29-9-7-6-8-27(29)37-28)23-33(42)39-18-16-38(17-19-39)25-11-13-26(43-3)14-12-25/h6-15,20,35,37H,16-19,21-23H2,1-5H3 |
| InChIKey | KEPXCVQOXDKWMX-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|