C33H33Cl3N4O2 — CID 19056048
5-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-6-(3,4-dichlorophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 19056048) has the molecular formula C33H33Cl3N4O2 and a molecular weight of 624.01 g/mol. Its IUPAC name is 5-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-6-(3,4-dichlorophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-6-(3,4-dichlorophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 19056048 |
| Molecular Formula | C33H33Cl3N4O2 |
| Molecular Weight | 624.01 g/mol |
| Exact Mass | 622.17 |
| IUPAC Name | 5-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-6-(3,4-dichlorophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(CC(=O)N1CCN(c3ccc(Cl)cc3)CC1)C2c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C33H33Cl3N4O2/c1-33(2)18-27-31(29(41)19-33)32(21-7-12-24(35)25(36)17-21)40(28-6-4-3-5-26(28)37-27)20-30(42)39-15-13-38(14-16-39)23-10-8-22(34)9-11-23/h3-12,17,32,37H,13-16,18-20H2,1-2H3 |
| InChIKey | FCVFYTGIDVTLAA-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.01 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |