C34H37ClN4O3 — CID 19056857
5-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-6-(3-methoxyphenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 19056857) has the molecular formula C34H37ClN4O3 and a molecular weight of 585.15 g/mol. Its IUPAC name is 5-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-6-(3-methoxyphenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-6-(3-methoxyphenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 19056857 |
| Molecular Formula | C34H37ClN4O3 |
| Molecular Weight | 585.15 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | 5-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-6-(3-methoxyphenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1cccc(C2C3=C(CC(C)(C)CC3=O)Nc3ccccc3N2CC(=O)N2CCN(c3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C34H37ClN4O3/c1-34(2)20-28-32(30(40)21-34)33(23-7-6-8-26(19-23)42-3)39(29-10-5-4-9-27(29)36-28)22-31(41)38-17-15-37(16-18-38)25-13-11-24(35)12-14-25/h4-14,19,33,36H,15-18,20-22H2,1-3H3 |
| InChIKey | QMQKSRXAXIIYIM-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.15 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |