C33H34Cl2N4O2 — CID 19055979
6-(2,4-dichlorophenyl)-9,9-dimethyl-5-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 19055979) has the molecular formula C33H34Cl2N4O2 and a molecular weight of 589.57 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-9,9-dimethyl-5-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(2,4-dichlorophenyl)-9,9-dimethyl-5-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 19055979 |
| Molecular Formula | C33H34Cl2N4O2 |
| Molecular Weight | 589.57 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-9,9-dimethyl-5-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(CC(=O)N1CCN(c3ccccc3)CC1)C2c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C33H34Cl2N4O2/c1-33(2)19-27-31(29(40)20-33)32(24-13-12-22(34)18-25(24)35)39(28-11-7-6-10-26(28)36-27)21-30(41)38-16-14-37(15-17-38)23-8-4-3-5-9-23/h3-13,18,32,36H,14-17,19-21H2,1-2H3 |
| InChIKey | WRRARUOITSMPLG-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.57 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |