C40H38Cl2F2N4O2 — CID 19056049
5-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]-6-(3,4-dichlorophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 19056049) has the molecular formula C40H38Cl2F2N4O2 and a molecular weight of 715.67 g/mol. Its IUPAC name is 5-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]-6-(3,4-dichlorophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]-6-(3,4-dichlorophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 19056049 |
| Molecular Formula | C40H38Cl2F2N4O2 |
| Molecular Weight | 715.67 g/mol |
| Exact Mass | 714.23 |
| IUPAC Name | 5-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]-6-(3,4-dichlorophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(CC(=O)N1CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC1)C2c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C40H38Cl2F2N4O2/c1-40(2)22-33-37(35(49)23-40)39(27-11-16-30(41)31(42)21-27)48(34-6-4-3-5-32(34)45-33)24-36(50)46-17-19-47(20-18-46)38(25-7-12-28(43)13-8-25)26-9-14-29(44)15-10-26/h3-16,21,38-39,45H,17-20,22-24H2,1-2H3 |
| InChIKey | GZEOVJVBOBSIKR-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.67 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |