C44H48F2N4O2 — CID 19055207
5-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]-6-(4-tert-butylphenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 19055207) has the molecular formula C44H48F2N4O2 and a molecular weight of 702.89 g/mol. Its IUPAC name is 5-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]-6-(4-tert-butylphenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]-6-(4-tert-butylphenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 19055207 |
| Molecular Formula | C44H48F2N4O2 |
| Molecular Weight | 702.89 g/mol |
| Exact Mass | 702.37 |
| IUPAC Name | 5-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]-6-(4-tert-butylphenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(CC(=O)N1CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC1)C2c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C44H48F2N4O2/c1-43(2,3)32-16-10-31(11-17-32)42-40-36(26-44(4,5)27-38(40)51)47-35-8-6-7-9-37(35)50(42)28-39(52)48-22-24-49(25-23-48)41(29-12-18-33(45)19-13-29)30-14-20-34(46)21-15-30/h6-21,41-42,47H,22-28H2,1-5H3 |
| InChIKey | UGXVUNRIMZFZCG-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.89 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |