C40H41N5O4 — CID 19055862
5-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]-9,9-dimethyl-6-(4-nitrophenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 19055862) has the molecular formula C40H41N5O4 and a molecular weight of 655.80 g/mol. Its IUPAC name is 5-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]-9,9-dimethyl-6-(4-nitrophenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]-9,9-dimethyl-6-(4-nitrophenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 19055862 |
| Molecular Formula | C40H41N5O4 |
| Molecular Weight | 655.80 g/mol |
| Exact Mass | 655.32 |
| IUPAC Name | 5-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]-9,9-dimethyl-6-(4-nitrophenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(CC(=O)N1CCN(C(c3ccccc3)c3ccccc3)CC1)C2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C40H41N5O4/c1-40(2)25-33-37(35(46)26-40)39(30-17-19-31(20-18-30)45(48)49)44(34-16-10-9-15-32(34)41-33)27-36(47)42-21-23-43(24-22-42)38(28-11-5-3-6-12-28)29-13-7-4-8-14-29/h3-20,38-39,41H,21-27H2,1-2H3 |
| InChIKey | XZISVSIUHAUIPJ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.80 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|