C34H39N5O4 — CID 19055364
6-(2,3-dimethoxyphenyl)-9,9-dimethyl-5-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 19055364) has the molecular formula C34H39N5O4 and a molecular weight of 581.72 g/mol. Its IUPAC name is 6-(2,3-dimethoxyphenyl)-9,9-dimethyl-5-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(2,3-dimethoxyphenyl)-9,9-dimethyl-5-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 19055364 |
| Molecular Formula | C34H39N5O4 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | 6-(2,3-dimethoxyphenyl)-9,9-dimethyl-5-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1cccc(C2C3=C(CC(C)(C)CC3=O)Nc3ccccc3N2CC(=O)N2CCN(c3ccccn3)CC2)c1OC |
| InChI | InChI=1S/C34H39N5O4/c1-34(2)20-25-31(27(40)21-34)32(23-10-9-13-28(42-3)33(23)43-4)39(26-12-6-5-11-24(26)36-25)22-30(41)38-18-16-37(17-19-38)29-14-7-8-15-35-29/h5-15,32,36H,16-22H2,1-4H3 |
| InChIKey | IZYKBMHYXCESEN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |