C34H34ClN5O2S — CID 19056112
5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-2-oxoethyl]-6-(2-chlorophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 19056112) has the molecular formula C34H34ClN5O2S and a molecular weight of 612.20 g/mol. Its IUPAC name is 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-2-oxoethyl]-6-(2-chlorophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-2-oxoethyl]-6-(2-chlorophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 19056112 |
| Molecular Formula | C34H34ClN5O2S |
| Molecular Weight | 612.20 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-2-oxoethyl]-6-(2-chlorophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(CC(=O)N1CCN(c3nsc4ccccc34)CC1)C2c1ccccc1Cl |
| InChI | InChI=1S/C34H34ClN5O2S/c1-34(2)19-26-31(28(41)20-34)32(22-9-3-5-11-24(22)35)40(27-13-7-6-12-25(27)36-26)21-30(42)38-15-17-39(18-16-38)33-23-10-4-8-14-29(23)43-37-33/h3-14,32,36H,15-21H2,1-2H3 |
| InChIKey | KVCBULZLLYNIKE-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.20 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |