C29H35N3O4 — CID 19055285
2-[6-(2-methoxyphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 19055285) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is 2-[6-(2-methoxyphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[6-(2-methoxyphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 19055285 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 2-[6-(2-methoxyphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | COc1ccccc1C1C2=C(CC(C)(C)CC2=O)Nc2ccccc2N1CC(=O)NCC1CCCO1 |
| InChI | InChI=1S/C29H35N3O4/c1-29(2)15-22-27(24(33)16-29)28(20-10-4-7-13-25(20)35-3)32(23-12-6-5-11-21(23)31-22)18-26(34)30-17-19-9-8-14-36-19/h4-7,10-13,19,28,31H,8-9,14-18H2,1-3H3,(H,30,34) |
| InChIKey | OJKRPXFRHXMTPG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |