C27H33N3O2 — CID 19056704
2-(6-ethyl-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)-N-(2-phenylethyl)acetamide (PubChem CID 19056704) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 2-(6-ethyl-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)-N-(2-phenylethyl)acetamide.
| Compound Name | 2-(6-ethyl-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 19056704 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 2-(6-ethyl-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)-N-(2-phenylethyl)acetamide |
| SMILES | CCC1C2=C(CC(C)(C)CC2=O)Nc2ccccc2N1CC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C27H33N3O2/c1-4-22-26-21(16-27(2,3)17-24(26)31)29-20-12-8-9-13-23(20)30(22)18-25(32)28-15-14-19-10-6-5-7-11-19/h5-13,22,29H,4,14-18H2,1-3H3,(H,28,32) |
| InChIKey | AKRAUJXIVWJLQA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |