C31H37N3O2 — CID 19056756
2-(6-cyclohex-3-en-1-yl-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)-N-(2-phenylethyl)acetamide (PubChem CID 19056756) has the molecular formula C31H37N3O2 and a molecular weight of 483.66 g/mol. Its IUPAC name is 2-(6-cyclohex-3-en-1-yl-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)-N-(2-phenylethyl)acetamide.
| Compound Name | 2-(6-cyclohex-3-en-1-yl-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 19056756 |
| Molecular Formula | C31H37N3O2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | 2-(6-cyclohex-3-en-1-yl-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)-N-(2-phenylethyl)acetamide |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(CC(=O)NCCc1ccccc1)C2C1CC=CCC1 |
| InChI | InChI=1S/C31H37N3O2/c1-31(2)19-25-29(27(35)20-31)30(23-13-7-4-8-14-23)34(26-16-10-9-15-24(26)33-25)21-28(36)32-18-17-22-11-5-3-6-12-22/h3-7,9-12,15-16,23,30,33H,8,13-14,17-21H2,1-2H3,(H,32,36) |
| InChIKey | BKGPXQHVESSRAU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|