C29H40N4O3 — CID 19056766
2-(6-cyclohex-3-en-1-yl-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 19056766) has the molecular formula C29H40N4O3 and a molecular weight of 492.66 g/mol. Its IUPAC name is 2-(6-cyclohex-3-en-1-yl-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-(6-cyclohex-3-en-1-yl-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 19056766 |
| Molecular Formula | C29H40N4O3 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | 2-(6-cyclohex-3-en-1-yl-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(CC(=O)NCCN1CCOCC1)C2C1CC=CCC1 |
| InChI | InChI=1S/C29H40N4O3/c1-29(2)18-23-27(25(34)19-29)28(21-8-4-3-5-9-21)33(24-11-7-6-10-22(24)31-23)20-26(35)30-12-13-32-14-16-36-17-15-32/h3-4,6-7,10-11,21,28,31H,5,8-9,12-20H2,1-2H3,(H,30,35) |
| InChIKey | XDPXUQXQERPSPS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|