C31H38N4O5 — CID 19056887
methyl 4-[9,9-dimethyl-5-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-6-yl]benzoate (PubChem CID 19056887) has the molecular formula C31H38N4O5 and a molecular weight of 546.67 g/mol. Its IUPAC name is methyl 4-[9,9-dimethyl-5-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-6-yl]benzoate.
| Compound Name | methyl 4-[9,9-dimethyl-5-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-6-yl]benzoate |
|---|---|
| PubChem CID | 19056887 |
| Molecular Formula | C31H38N4O5 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | methyl 4-[9,9-dimethyl-5-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-6-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3ccccc3N2CC(=O)NCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C31H38N4O5/c1-31(2)18-24-28(26(36)19-31)29(21-8-10-22(11-9-21)30(38)39-3)35(25-7-5-4-6-23(25)33-24)20-27(37)32-12-13-34-14-16-40-17-15-34/h4-11,29,33H,12-20H2,1-3H3,(H,32,37) |
| InChIKey | FUPYLEPRUYFZBN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |