C11H10ClNO3 — CID 70127349
(2S)-1-(2-chloroacetyl)-2,3-dihydroindole-2-carboxylic acid (PubChem CID 70127349) has the molecular formula C11H10ClNO3 and a molecular weight of 239.66 g/mol. Its IUPAC name is (2S)-1-(2-chloroacetyl)-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | (2S)-1-(2-chloroacetyl)-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 70127349 |
| Molecular Formula | C11H10ClNO3 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | (2S)-1-(2-chloroacetyl)-2,3-dihydroindole-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1Cc2ccccc2N1C(=O)CCl |
| InChI | InChI=1S/C11H10ClNO3/c12-6-10(14)13-8-4-2-1-3-7(8)5-9(13)11(15)16/h1-4,9H,5-6H2,(H,15,16)/t9-/m0/s1 |
| InChIKey | XTTVNNQMFMOZRA-VIFPVBQESA-N |
| XLogP | 1.27 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|