C24H24N2O6S2 — CID 12764263
1-[3-[[3-(2-carboxy-2,3-dihydroindol-1-yl)-3-oxopropyl]disulfanyl]propanoyl]-2,3-dihydroindole-2-carboxylic acid (PubChem CID 12764263) has the molecular formula C24H24N2O6S2 and a molecular weight of 500.60 g/mol. Its IUPAC name is 1-[3-[[3-(2-carboxy-2,3-dihydroindol-1-yl)-3-oxopropyl]disulfanyl]propanoyl]-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | 1-[3-[[3-(2-carboxy-2,3-dihydroindol-1-yl)-3-oxopropyl]disulfanyl]propanoyl]-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 12764263 |
| Molecular Formula | C24H24N2O6S2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | 1-[3-[[3-(2-carboxy-2,3-dihydroindol-1-yl)-3-oxopropyl]disulfanyl]propanoyl]-2,3-dihydroindole-2-carboxylic acid |
| SMILES | O=C(O)C1Cc2ccccc2N1C(=O)CCSSCCC(=O)N1c2ccccc2CC1C(=O)O |
| InChI | InChI=1S/C24H24N2O6S2/c27-21(25-17-7-3-1-5-15(17)13-19(25)23(29)30)9-11-33-34-12-10-22(28)26-18-8-4-2-6-16(18)14-20(26)24(31)32/h1-8,19-20H,9-14H2,(H,29,30)(H,31,32) |
| InChIKey | ZDIUTNMOPDEBCN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|