C13H15NO4 — CID 28779680
(2S)-1-(2-ethoxyacetyl)-2,3-dihydroindole-2-carboxylic acid (PubChem CID 28779680) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is (2S)-1-(2-ethoxyacetyl)-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | (2S)-1-(2-ethoxyacetyl)-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 28779680 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2S)-1-(2-ethoxyacetyl)-2,3-dihydroindole-2-carboxylic acid |
| SMILES | CCOCC(=O)N1c2ccccc2C[C@H]1C(=O)O |
| InChI | InChI=1S/C13H15NO4/c1-2-18-8-12(15)14-10-6-4-3-5-9(10)7-11(14)13(16)17/h3-6,11H,2,7-8H2,1H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | HHSFMBZEHBWYAK-NSHDSACASA-N |
| XLogP | 1.07 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |