C11H15N2O2+ — CID 162469017
[(1S)-1-carboxy-2-(2,3-dihydro-1H-indol-3-yl)ethyl]azanium (PubChem CID 162469017) has the molecular formula C11H15N2O2+ and a molecular weight of 207.25 g/mol. Its IUPAC name is [(1S)-1-carboxy-2-(2,3-dihydro-1H-indol-3-yl)ethyl]azanium.
| Compound Name | [(1S)-1-carboxy-2-(2,3-dihydro-1H-indol-3-yl)ethyl]azanium |
|---|---|
| PubChem CID | 162469017 |
| Molecular Formula | C11H15N2O2+ |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | [(1S)-1-carboxy-2-(2,3-dihydro-1H-indol-3-yl)ethyl]azanium |
| SMILES | [NH3+][C@@H](CC1CNc2ccccc21)C(=O)O |
| InChI | InChI=1S/C11H14N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,7,9,13H,5-6,12H2,(H,14,15)/p+1/t7?,9-/m0/s1 |
| InChIKey | SPHNJDOWMOXSMT-NETXQHHPSA-O |
| XLogP | 0.28 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |