C12H16N2O — CID 158622438
3-(deuterioamino)-4-(2,3-dihydro-1H-indol-3-yl)butan-2-one (PubChem CID 158622438) has the molecular formula C12H16N2O and a molecular weight of 205.28 g/mol. Its IUPAC name is 3-(deuterioamino)-4-(2,3-dihydro-1H-indol-3-yl)butan-2-one.
| Compound Name | 3-(deuterioamino)-4-(2,3-dihydro-1H-indol-3-yl)butan-2-one |
|---|---|
| PubChem CID | 158622438 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 3-(deuterioamino)-4-(2,3-dihydro-1H-indol-3-yl)butan-2-one |
| SMILES | [2H]NC(CC1CNc2ccccc21)C(C)=O |
| InChI | InChI=1S/C12H16N2O/c1-8(15)11(13)6-9-7-14-12-5-3-2-4-10(9)12/h2-5,9,11,14H,6-7,13H2,1H3/i/hD |
| InChIKey | WHPYIMOEGVEBON-DYCDLGHISA-N |
| XLogP | 1.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |