C16H19N3 — CID 82156838
3-ethyl-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline (PubChem CID 82156838) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 3-ethyl-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline.
| Compound Name | 3-ethyl-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 82156838 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 3-ethyl-4-(pyridin-3-ylmethyl)-2,3-dihydro-1H-quinoxaline |
| SMILES | CCC1CNc2ccccc2N1Cc1cccnc1 |
| InChI | InChI=1S/C16H19N3/c1-2-14-11-18-15-7-3-4-8-16(15)19(14)12-13-6-5-9-17-10-13/h3-10,14,18H,2,11-12H2,1H3 |
| InChIKey | PMAYSMKUPJMMCO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |