C18H20N4O2 — CID 155810252
(3S,6S)-3,6-dimethyl-1,4-bis(pyridin-3-ylmethyl)piperazine-2,5-dione (PubChem CID 155810252) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is (3S,6S)-3,6-dimethyl-1,4-bis(pyridin-3-ylmethyl)piperazine-2,5-dione.
| Compound Name | (3S,6S)-3,6-dimethyl-1,4-bis(pyridin-3-ylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 155810252 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (3S,6S)-3,6-dimethyl-1,4-bis(pyridin-3-ylmethyl)piperazine-2,5-dione |
| SMILES | C[C@H]1C(=O)N(Cc2cccnc2)[C@@H](C)C(=O)N1Cc1cccnc1 |
| InChI | InChI=1S/C18H20N4O2/c1-13-17(23)22(12-16-6-4-8-20-10-16)14(2)18(24)21(13)11-15-5-3-7-19-9-15/h3-10,13-14H,11-12H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | ZPUVMIVDJVZWLQ-KBPBESRZSA-N |
| XLogP | 1.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |