C12H16N2OS — CID 74224086
2-propyl-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 74224086) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 2-propyl-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-propyl-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 74224086 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-propyl-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | CCCC1SCC(=O)N1Cc1cccnc1 |
| InChI | InChI=1S/C12H16N2OS/c1-2-4-12-14(11(15)9-16-12)8-10-5-3-6-13-7-10/h3,5-7,12H,2,4,8-9H2,1H3 |
| InChIKey | BBEROARQGOKQID-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |